Information card for entry 2202550
| Chemical name |
4-Amino-2-(p-chlorophenyl)-5-methyl-3,4-dihydro-2H-1,2,4-triazol-3-one |
| Formula |
C9 H9 Cl N4 O |
| Calculated formula |
C9 H9 Cl N4 O |
| SMILES |
Clc1ccc(n2nc(n(N)c2=O)C)cc1 |
| Title of publication |
4-Amino-2-(<i>p</i>-chlorophenyl)-5-methyl-3,4-dihydro-2<i>H</i>-1,2,4-triazol-3-one |
| Authors of publication |
Thamotharan, S.; Parthasarathi, V.; Kavali, Jyoti R.; Badami, Bharati; Schenk, Kurt J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
7 |
| Pages of publication |
o964 - o966 |
| a |
4.0135 ± 0.0008 Å |
| b |
11.691 ± 0.002 Å |
| c |
11.986 ± 0.002 Å |
| α |
117.09 ± 0.03° |
| β |
90.79 ± 0.03° |
| γ |
91.89 ± 0.03° |
| Cell volume |
500.2 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0482 |
| Residual factor for significantly intense reflections |
0.0422 |
| Weighted residual factors for significantly intense reflections |
0.1117 |
| Weighted residual factors for all reflections included in the refinement |
0.1173 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202550.html