Information card for entry 2202583
| Common name |
Fulvic acid |
| Chemical name |
3,7,8-Trihydroxy-3-methyl-10-oxo-4,10-dihydro-1H,3H-pyrano[4,3-b]chromene- 9-carboxylic acid (fulvic acid) |
| Formula |
C14.75 H15 O8.75 |
| Calculated formula |
C14.75 H15 O8.75 |
| SMILES |
o1c2cc(O)c(O)c(c2c(=O)c2c1CC(OC2)(O)C)C(=O)O.OC |
| Title of publication |
3,7,8-Trihydroxy-3-methyl-10-oxo-4,10-dihydro-1<i>H</i>,3<i>H</i>-pyrano[4,3-<i>b</i>]chromene-9-carboxylic acid (fulvic acid) methanol 0.75-solvate |
| Authors of publication |
Wang, Jian-Feng; Fang, Mei-Juan; Huang, Hui-Qiong; Li, Gui-Ling; Su, Wen-Jin; Zhao, Yu-Fen |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
10 |
| Pages of publication |
o1517 - o1518 |
| a |
12.483 ± 0.0007 Å |
| b |
12.6558 ± 0.0008 Å |
| c |
19.0259 ± 0.0013 Å |
| α |
94.608 ± 0.003° |
| β |
100.871 ± 0.003° |
| γ |
98.399 ± 0.003° |
| Cell volume |
2902.1 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1625 |
| Residual factor for significantly intense reflections |
0.0746 |
| Weighted residual factors for significantly intense reflections |
0.1531 |
| Weighted residual factors for all reflections included in the refinement |
0.1958 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202583.html