Information card for entry 2202587
| Chemical name |
N,N'-Bis(aminopropyl)-1,4-benzylidenediammonium diperchlorate |
| Formula |
C14 H24 Cl2 N4 O8 |
| Calculated formula |
C14 H24 Cl2 N4 O8 |
| SMILES |
c1(/C=N/CCC[NH3+])ccc(cc1)/C=N/CCC[NH3+].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O |
| Title of publication |
<i>N,N</i>'-Bis(aminopropyl)-1,4-benzylidenediammonium diperchlorate |
| Authors of publication |
Yang, Shi-Ping; Chen, Hong-Mei; Znang, Fan; Yu, Xi-Bin; Weng, lin-Hong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
11 |
| Pages of publication |
o1830 - o1831 |
| a |
13.358 ± 0.003 Å |
| b |
7.864 ± 0.002 Å |
| c |
9.313 ± 0.002 Å |
| α |
90° |
| β |
91.714 ± 0.003° |
| γ |
90° |
| Cell volume |
977.9 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0552 |
| Residual factor for significantly intense reflections |
0.0493 |
| Weighted residual factors for significantly intense reflections |
0.1318 |
| Weighted residual factors for all reflections included in the refinement |
0.1384 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202587.html