Information card for entry 2202998
| Chemical name |
9-Chloro-5,5-dimethyl-2,3-diphenyl-2,3-dihydroimidazo[1,2-c]quinazoline |
| Formula |
C24 H20 Cl N3 |
| Calculated formula |
C24 H20 Cl N3 |
| SMILES |
Clc1cc2c(NC(n3c2nc(c3c2ccccc2)c2ccccc2)(C)C)cc1 |
| Title of publication |
9-Chloro-5,5-dimethyl-2,3-diphenyl-2,3-dihydroimidazo[1,2-<i>c</i>]quinazoline |
| Authors of publication |
Shi, Daqing; Wang, Juxian; Shi, Chunling; Rong, Liangce; Wang, Xiangshan; Hu, Hongwen |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
11 |
| Pages of publication |
o1661 - o1662 |
| a |
8.955 ± 0.001 Å |
| b |
17.568 ± 0.002 Å |
| c |
13.075 ± 0.002 Å |
| α |
90° |
| β |
90.26 ± 0.01° |
| γ |
90° |
| Cell volume |
2057 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0753 |
| Residual factor for significantly intense reflections |
0.0404 |
| Weighted residual factors for significantly intense reflections |
0.1003 |
| Weighted residual factors for all reflections included in the refinement |
0.1092 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.881 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202998.html