Information card for entry 2203003
| Chemical name |
2,7,12-Tris(2-bromoethoxy)-3,8,13-trimethoxy-10,15-dihydro-5H- tribenzo[a,d,g]cyclononaene |
| Formula |
C30 H33 Br3 O6 |
| Calculated formula |
C30 H33 Br3 O6 |
| SMILES |
BrCCOc1cc2Cc3cc(OC)c(cc3Cc3c(Cc2cc1OC)cc(OCCBr)c(c3)OC)OCCBr |
| Title of publication |
2,7,12-Tris(2-bromoethoxy)-3,8,13-trimethoxy-10,15-dihydro-5<i>H</i>-tribenzo[<i>a,d,g</i>]cyclononaene |
| Authors of publication |
Wang, Song-Qing; Zeng, Guo; Zheng, Xiu-Fang; Zhao, Kang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
12 |
| Pages of publication |
o1862 - o1863 |
| a |
14.585 ± 0.003 Å |
| b |
8.3893 ± 0.0019 Å |
| c |
24.881 ± 0.006 Å |
| α |
90° |
| β |
98.507 ± 0.004° |
| γ |
90° |
| Cell volume |
3010.9 ± 1.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.121 |
| Residual factor for significantly intense reflections |
0.0632 |
| Weighted residual factors for all reflections included in the refinement |
0.1642 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203003.html