Information card for entry 2203136
| Common name |
(2R*,5S*)-Bicyclic chloromethyl phosphonamide |
| Chemical name |
(1R*,3aS*)-1-(chloromethyl)-1λ^5^-phospha-2,6a-diazaperhydropentalene 1-oxide dihydrate |
| Formula |
C12 H20 Cl N2 O3 P |
| Calculated formula |
C12 H20 Cl N2 O3 P |
| SMILES |
ClCP1(=O)N(c2ccccc2)CC2N1CCC2.O.O |
| Title of publication |
(1<i>RS</i>,3a<i>SR</i>)-1-(chloromethyl)-1λ^5^-phospha-2,6a-diazaperhydropentalene 1-oxide dihydrate |
| Authors of publication |
Chen, Dimei; Zhong, Ping; Ding, Jinchang; Yuan, Chengye |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
2 |
| Pages of publication |
o237 - o238 |
| a |
10.8756 ± 0.0004 Å |
| b |
8.939 ± 0.0003 Å |
| c |
31.227 ± 0.001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3035.79 ± 0.18 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.053 |
| Residual factor for significantly intense reflections |
0.0438 |
| Weighted residual factors for significantly intense reflections |
0.1215 |
| Weighted residual factors for all reflections included in the refinement |
0.1283 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203136.html