Information card for entry 2203545
| Formula |
C10 H14 O4 S |
| Calculated formula |
C10 H14 O4 S |
| SMILES |
C1CC=C[C@H]2S(=O)(=O)CCOC(=O)[C@@]12C.C1CC=C[C@@H]2S(=O)(=O)CCOC(=O)[C@]12C |
| Title of publication |
(4a<i>SR</i>,9a<i>SR</i>)-9a-Methyl-5,5-dioxo-1,2,4a,6,7,9a-hexahydro-8-oxa-5λ^6^-thiabenzo-1,4-cyclohepten-9-one |
| Authors of publication |
Zeller, Matthias; Hunter, Allen D.; Sampson, Paul; Chumachenko, Nataliya |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
5 |
| Pages of publication |
o731 - o732 |
| a |
10.9599 ± 0.0008 Å |
| b |
22.4386 ± 0.0016 Å |
| c |
9.1966 ± 0.0007 Å |
| α |
90° |
| β |
113.69 ± 0.001° |
| γ |
90° |
| Cell volume |
2071.1 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0398 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.1007 |
| Weighted residual factors for all reflections included in the refinement |
0.1022 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.067 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203545.html