Information card for entry 2204373
| Chemical name |
3,3,6,6-Tetramethyl-N-hydroxy-9-(4-fluorophenyl)-1,2,3,4,5,6,7,8,9,10- decahydroacridine-1,8-dione monohydrate |
| Formula |
C23 H28 F N O4 |
| Calculated formula |
C23 H28 F N O4 |
| SMILES |
Fc1ccc(cc1)C1C2=C(N(O)C3=C1C(=O)CC(C3)(C)C)CC(CC2=O)(C)C.O |
| Title of publication |
9-(4-Fluorophenyl)-<i>N</i>-hydroxy-3,3,6,6-tetramethyl-1,2,3,4,5,6,7,8,9,10-decahydroacridine-1,8-dione monohydrate |
| Authors of publication |
Shujiang Tu; Fang Fang; Songlei Zhu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
10 |
| Pages of publication |
o1677 - o1679 |
| a |
12.638 ± 0.002 Å |
| b |
14.039 ± 0.003 Å |
| c |
12.102 ± 0.002 Å |
| α |
90° |
| β |
94.6 ± 0.01° |
| γ |
90° |
| Cell volume |
2140.3 ± 0.7 Å3 |
| Cell temperature |
288 ± 2 K |
| Ambient diffraction temperature |
288 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0746 |
| Residual factor for significantly intense reflections |
0.0398 |
| Weighted residual factors for significantly intense reflections |
0.0932 |
| Weighted residual factors for all reflections included in the refinement |
0.102 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.906 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204373.html