Information card for entry 2204895
| Chemical name |
4-(2,6-Dichlorobenzylamino)-3,5-diphenyl-4H-1,2,4-triazole |
| Formula |
C21 H16 Cl2 N4 |
| Calculated formula |
C21 H16 Cl2 N4 |
| SMILES |
c1cc(c2n(NCc3c(Cl)cccc3Cl)c(c3ccccc3)nn2)ccc1 |
| Title of publication |
4-(2,6-Dichlorobenzylamino)-3,5-diphenyl-4<i>H</i>-1,2,4-triazole |
| Authors of publication |
Atalay, Şehriman; Yavuz, Metin; Bekircan, Olcay; Alpay Karaoǧlu, Şengül; Şahinbaş, Esra; Şaşmaz, Selami |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
1 |
| Pages of publication |
o90 - o92 |
| a |
23.5075 ± 0.0013 Å |
| b |
13.9199 ± 0.001 Å |
| c |
11.531 ± 0.008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3773 ± 3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0912 |
| Residual factor for significantly intense reflections |
0.0356 |
| Weighted residual factors for significantly intense reflections |
0.0688 |
| Weighted residual factors for all reflections included in the refinement |
0.0791 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.752 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204895.html