Information card for entry 2204962
| Chemical name |
(3aS,10R,10aS,10bS,13R,13aR)-8-formyl-6-hydroxy-13-methoxy-1,1,7-trimethyl- 5-oxo-1,2,3,3a,5,9,10,10a,13,13a-decahydrocyclohepta[c]furo[3,4-e]chromen-10-yl acetate |
| Formula |
C23 H30 O8 |
| Calculated formula |
C23 H30 O8 |
| SMILES |
O=C1O[C@H]2CCC([C@@H]3[C@@]2([C@H]2C1=C(C(=C(C[C@H]2OC(=O)C)C=O)C)O)CO[C@H]3OC)(C)C |
| Title of publication |
(3a<i>S</i>*,10<i>R</i>*,10a<i>S</i>*,10b<i>S</i>*,13<i>R</i>*,13a<i>R</i>*)-8-Formyl-6-hydroxy-13-methoxy-1,1,7-trimethyl-5-oxo-1,2,3,3a,5,9,10,10a,13,13a-decahydrocyclohepta[<i>c</i>]furo[3,4-<i>e</i>]chromen-10-yl acetate |
| Authors of publication |
Shi, Hao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
1 |
| Pages of publication |
o12 - o14 |
| a |
11.6288 ± 0.0009 Å |
| b |
14.0386 ± 0.0011 Å |
| c |
13.7457 ± 0.001 Å |
| α |
90° |
| β |
98.349 ± 0.001° |
| γ |
90° |
| Cell volume |
2220.2 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0573 |
| Residual factor for significantly intense reflections |
0.0477 |
| Weighted residual factors for significantly intense reflections |
0.1128 |
| Weighted residual factors for all reflections included in the refinement |
0.1188 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.836 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2204962.html