Information card for entry 2205020
| Chemical name |
2-Azido-2-deoxy-3,4-O-isopropylidene-2-C-methyl-D-ribono-1,5-lactone |
| Formula |
C9 H13 N3 O4 |
| Calculated formula |
C9 H13 N3 O4 |
| SMILES |
[C@@]1([C@H]2[C@H](OC(O2)(C)C)COC1=O)(N=N#N)C |
| Title of publication |
2-Azido-2-deoxy-3,4-<i>O</i>-isopropylidene-2-<i>C</i>-methyl-<small>D</small>-ribono-1,5-lactone |
| Authors of publication |
Punzo, Francesco; Watkin, David J.; Jenkinson, Sarah F.; da Cruz, Filipa P.; Fleet, George W. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
2 |
| Pages of publication |
o511 - o512 |
| a |
6.4862 ± 0.0001 Å |
| b |
27.931 ± 0.0005 Å |
| c |
6.4787 ± 0.0001 Å |
| α |
90° |
| β |
109.894 ± 0.0007° |
| γ |
90° |
| Cell volume |
1103.68 ± 0.03 Å3 |
| Cell temperature |
120 K |
| Ambient diffraction temperature |
120 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.063 |
| Residual factor for significantly intense reflections |
0.0446 |
| Weighted residual factors for all reflections |
0.1018 |
| Weighted residual factors for significantly intense reflections |
0.0953 |
| Weighted residual factors for all reflections included in the refinement |
0.1018 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9941 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205020.html