Information card for entry 2205059
| Common name |
16α,17-Epoxypregn-4-ene-3,11,20-trione |
| Chemical name |
17-acetyl-10,13-dimethyl-1,2,6,7,9,10,12,13,14,15,16, 17-dodecahydro-8H-20-oxa-cyclopropa[16,17]cyclopenta[a]phenanthrene-3,11-dione |
| Formula |
C21 H26 O4 |
| Calculated formula |
C21 H26 O4 |
| SMILES |
O=C1CC[C@]2(C(=C1)CC[C@@H]1[C@@H]2C(=O)C[C@]2([C@H]1C[C@H]1O[C@@]21C(=O)C)C)C |
| Title of publication |
16α,17-Epoxypregn-4-ene-3,11,20-trione |
| Authors of publication |
Nie, Qiang; Wang, Jingkang; Wang, Shi; Zhang, Meijing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
2 |
| Pages of publication |
o398 - o399 |
| a |
7.5364 ± 0.0012 Å |
| b |
9.9 ± 0.0016 Å |
| c |
23.288 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1737.5 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0524 |
| Residual factor for significantly intense reflections |
0.0396 |
| Weighted residual factors for significantly intense reflections |
0.1023 |
| Weighted residual factors for all reflections included in the refinement |
0.1086 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.073 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205059.html