Information card for entry 2205084
| Chemical name |
1,1,3,3-Tetraphenyl-1,2,3-triphosphenium tetrachloroaluminate dichloromethane solvate |
| Formula |
C28 H28 Al Cl6 P3 |
| Calculated formula |
C28 H28 Al Cl6 P3 |
| SMILES |
P1=P(CCC[P+]1(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[Al](Cl)(Cl)(Cl)[Cl-].C(Cl)Cl |
| Title of publication |
1,1,3,3-Tetraphenyl-1,2,3-triphosphenium tetrachloroaluminate dichloromethane solvate |
| Authors of publication |
Deng, Robert M. K.; Dillon, Keith B.; Goeta, Andrés E.; Thompson, Amber L. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
2 |
| Pages of publication |
m296 - m298 |
| a |
9.4446 ± 0.0001 Å |
| b |
12.4158 ± 0.0001 Å |
| c |
15.0802 ± 0.0002 Å |
| α |
72.645 ± 0.001° |
| β |
78.207 ± 0.001° |
| γ |
77.39 ± 0.001° |
| Cell volume |
1628.61 ± 0.03 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0323 |
| Residual factor for significantly intense reflections |
0.0288 |
| Weighted residual factors for significantly intense reflections |
0.0727 |
| Weighted residual factors for all reflections included in the refinement |
0.0753 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205084.html