Information card for entry 2205199
| Chemical name |
Ethyl 2,3,5,6-tetramethylbenzoate |
| Formula |
C13 H18 O2 |
| Calculated formula |
C13 H18 O2 |
| SMILES |
O(C(=O)c1c(c(cc(c1C)C)C)C)CC |
| Title of publication |
Ethyl 2,3,5,6-tetramethylbenzoate |
| Authors of publication |
Pinkus, A. G.; Klausmeyer, Kevin K.; Feazell, Rodney P.; Lin, Ellen C. H. Y. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
3 |
| Pages of publication |
o662 - o663 |
| a |
18.223 ± 0.001 Å |
| b |
5.5837 ± 0.0004 Å |
| c |
11.5842 ± 0.0007 Å |
| α |
90° |
| β |
101.725 ± 0.004° |
| γ |
90° |
| Cell volume |
1154.12 ± 0.13 Å3 |
| Cell temperature |
110 ± 2 K |
| Ambient diffraction temperature |
110 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0567 |
| Residual factor for significantly intense reflections |
0.0387 |
| Weighted residual factors for significantly intense reflections |
0.0961 |
| Weighted residual factors for all reflections included in the refinement |
0.1076 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205199.html