Information card for entry 2205303
| Chemical name |
(1RS,2SR,7RS,8RS)-N-Benzoyltricyclo[6.2.2.0^2,7^]dodeca-9,11-diene-1,10- dicarboximide |
| Formula |
C21 H19 N O3 |
| Calculated formula |
C21 H19 N O3 |
| SMILES |
N1(C(=O)[C@]23[C@H]4CCCC[C@@H]4[C@H](C=C2C1=O)C=C3)C(=O)c1ccccc1.N1(C(=O)[C@@]23[C@@H]4CCCC[C@H]4[C@@H](C=C2C1=O)C=C3)C(=O)c1ccccc1 |
| Title of publication |
(1<i>RS</i>,2<i>S</i><i>R</i>,7<i>RS</i>,8<i>RS</i>)-<i>N</i>-Benzoyltricyclo[6.2.2.0^2,7^]dodeca-9,11-diene-1,10-dicarboximide |
| Authors of publication |
McSweeney, Nigel; Pratt, Albert C.; Long, Conor; Howie, R. Alan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
3 |
| Pages of publication |
o547 - o549 |
| a |
8.111 ± 0.003 Å |
| b |
12.999 ± 0.007 Å |
| c |
16.256 ± 0.005 Å |
| α |
90° |
| β |
100.76 ± 0.03° |
| γ |
90° |
| Cell volume |
1683.8 ± 1.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1699 |
| Residual factor for significantly intense reflections |
0.0876 |
| Weighted residual factors for significantly intense reflections |
0.1637 |
| Weighted residual factors for all reflections included in the refinement |
0.1922 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205303.html