Information card for entry 2205335
| Formula |
C46 H40 Cl6 N4 |
| Calculated formula |
C46 H40 Cl6 N4 |
| SMILES |
[nH]1c2=Cc3nc(=Cc4[nH]c(C=c5c6c(c(n5)C=c1c1c2[C@H]2CC[C@@H]1C=C2)[C@H]1CC[C@@H]6C=C1)c1c4[C@H]2CC[C@@H]1C=C2)c1c3[C@H]2CC[C@@H]1C=C2.C(Cl)(Cl)Cl.C(Cl)(Cl)Cl |
| Title of publication |
(1<i>RS</i>,4<i>S</i><i>R</i>,8<i>S</i><i>R</i>,11<i>RS</i>,15<i>S</i><i>R</i>,18<i>RS</i>,22<i>RS</i>,25<i>S</i><i>R</i>)-1,4:8,11:15,18:22,25-Tetraethano-29<i>H</i>,31<i>H</i>-tetrabenzo[<i>b,g,l,q</i>]porphine chloroform disolvate |
| Authors of publication |
Aramaki, Shinji; Sakai, Yoshimasa; Yanagisawa, Hiroyuki; Senju, Takatoshi; Mizuguchi, Jin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
3 |
| Pages of publication |
o675 - o677 |
| a |
10.282 ± 0.002 Å |
| b |
17.433 ± 0.003 Å |
| c |
11.664 ± 0.002 Å |
| α |
90° |
| β |
106.51 ± 0.01° |
| γ |
90° |
| Cell volume |
2004.5 ± 0.6 Å3 |
| Cell temperature |
93.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.125 |
| Weighted residual factors for all reflections included in the refinement |
0.311 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.324 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205335.html