Information card for entry 2205486
| Chemical name |
(S)-2-amino-1-butanol (2R,3R)-tartrate |
| Formula |
C8 H17 N O7 |
| Calculated formula |
C8 H17 N O7 |
| SMILES |
O=C(O)[C@H](O)[C@@H](O)C(=O)[O-].C([C@H](CC)[NH3+])O |
| Title of publication |
(<i>S</i>)-2-Ammoniobutan-1-ol (2<i>R</i>,3<i>R</i>)-tartrate |
| Authors of publication |
Bai, Guo-Yi; Chen, Li-Gong; Li, Yang; Yan, Xi-Long; Xing, Peng; Dong, Chuan-Ming; Duan, Xue-Min; Zhang, Yue-Cheng; Ge, Feng-Yan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
4 |
| Pages of publication |
o1125 - o1126 |
| a |
7.2959 ± 0.0007 Å |
| b |
9.4843 ± 0.0009 Å |
| c |
16.0204 ± 0.0016 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1108.56 ± 0.19 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0328 |
| Residual factor for significantly intense reflections |
0.0303 |
| Weighted residual factors for significantly intense reflections |
0.0814 |
| Weighted residual factors for all reflections included in the refinement |
0.0828 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205486.html