Information card for entry 2205673
| Chemical name |
N,N'-Bis[2-(dimethylamino)ethyl]dithiooxamide |
| Formula |
C10 H22 N4 S2 |
| Calculated formula |
C10 H22 N4 S2 |
| SMILES |
CN(CCNC(=S)C(=S)NCCN(C)C)C |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis[2-(dimethylamino)ethyl]dithiooxamide |
| Authors of publication |
Cui, Jian-Zhong; Zhang, Dan; Zhang, Hong; Pan, Shuo-Wen; Cheng, Peng; Liao, Dai-Zheng; Wang, Geng-Lin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
5 |
| Pages of publication |
o1496 - o1497 |
| a |
9.964 ± 0.002 Å |
| b |
7.284 ± 0.0016 Å |
| c |
11.462 ± 0.003 Å |
| α |
90° |
| β |
110.917 ± 0.003° |
| γ |
90° |
| Cell volume |
777.1 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0793 |
| Residual factor for significantly intense reflections |
0.0378 |
| Weighted residual factors for significantly intense reflections |
0.1011 |
| Weighted residual factors for all reflections included in the refinement |
0.1157 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.991 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205673.html