Information card for entry 2205791
| Chemical name |
Ethyl 3-oxo-1,2-benzoisothiazoline-2-acetate 1,1-dioxide |
| Formula |
C11 H11 N O5 S |
| Calculated formula |
C11 H11 N O5 S |
| SMILES |
S1(=O)(=O)N(C(=O)c2c1cccc2)CC(=O)OCC |
| Title of publication |
Ethyl 3-oxo-1,2-benzisothiazoline-2-acetate 1,1-dioxide |
| Authors of publication |
Xu, Liang-Zhong; Si, Guo-Dong; Li, Zai-Feng; Yang, Shuang-Hua; Li, Kai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
5 |
| Pages of publication |
o1329 - o1330 |
| a |
4.9278 ± 0.0006 Å |
| b |
12.6217 ± 0.0014 Å |
| c |
19.601 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1219.1 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0354 |
| Residual factor for significantly intense reflections |
0.0291 |
| Weighted residual factors for significantly intense reflections |
0.0732 |
| Weighted residual factors for all reflections included in the refinement |
0.0754 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205791.html