Information card for entry 2205921
| Common name |
Osajin |
| Chemical name |
5-hydroxy-3-(3-hydroxyphenyl)-8,8-dimethyl-6-(3-methylbut-2-enyl)- 4H,8H-pyrano[2,3-h]chromen-4-one |
| Formula |
C25 H24 O5 |
| Calculated formula |
C25 H24 O5 |
| SMILES |
o1cc(c(=O)c2c(O)c(c3OC(C=Cc3c12)(C)C)CC=C(C)C)c1ccc(O)cc1 |
| Title of publication |
Osajin |
| Authors of publication |
Lišková, Margita; Marek, Jaromír; Jankovská, Dagmar; Sukupová, Lada; Žemlička, Milan; Vančo, Jan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1848 - o1850 |
| a |
8.822 ± 0.0011 Å |
| b |
11.641 ± 0.002 Å |
| c |
21.504 ± 0.003 Å |
| α |
75.865 ± 0.011° |
| β |
87.731 ± 0.01° |
| γ |
72.474 ± 0.012° |
| Cell volume |
2040.7 ± 0.5 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1057 |
| Residual factor for significantly intense reflections |
0.0486 |
| Weighted residual factors for significantly intense reflections |
0.109 |
| Weighted residual factors for all reflections included in the refinement |
0.1247 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205921.html