Information card for entry 2205955
| Chemical name |
2,5,2'',5''-Tetramethyl-p-terphenyl |
| Formula |
C22 H22 |
| Calculated formula |
C22 H22 |
| SMILES |
c1(c(ccc(c1)C)C)c1ccc(cc1)c1c(ccc(c1)C)C |
| Title of publication |
2,5,2'',5''-Tetramethyl-<i>p</i>-terphenyl |
| Authors of publication |
Jones, Peter G.; Kuś, Piotr; Pasewicz, Anna |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1895 - o1896 |
| a |
6.1837 ± 0.0011 Å |
| b |
15.147 ± 0.002 Å |
| c |
17.536 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1642.5 ± 0.4 Å3 |
| Cell temperature |
133 ± 2 K |
| Ambient diffraction temperature |
133 ± 2 K |
| Number of distinct elements |
2 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0545 |
| Residual factor for significantly intense reflections |
0.045 |
| Weighted residual factors for significantly intense reflections |
0.1167 |
| Weighted residual factors for all reflections included in the refinement |
0.1222 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205955.html