Information card for entry 2205969
| Chemical name |
12-Bromo-1,2,3,4-tetrahydro-1,4-ethanoantracen-11-ol |
| Formula |
C16 H15 Br O |
| Calculated formula |
C16 H15 Br O |
| SMILES |
Br[C@H]1[C@H](O)[C@@H]2c3cc4c(cc3[C@H]1CC2)cccc4.Br[C@@H]1[C@@H](O)[C@H]2c3cc4c(cc3[C@@H]1CC2)cccc4 |
| Title of publication |
12-Bromo-1,2,3,4-tetrahydro-1,4-ethanoanthracen-11-ol |
| Authors of publication |
Çoruh, Ufuk; Altundaş, Aliye; Menzek, Abdullah; García-Granda, Santiago |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1869 - o1871 |
| a |
9.854 ± 0.001 Å |
| b |
12.316 ± 0.001 Å |
| c |
12.488 ± 0.001 Å |
| α |
79.928 ± 0.01° |
| β |
77.248 ± 0.01° |
| γ |
66.719 ± 0.01° |
| Cell volume |
1351.3 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0418 |
| Residual factor for significantly intense reflections |
0.0376 |
| Weighted residual factors for significantly intense reflections |
0.1006 |
| Weighted residual factors for all reflections included in the refinement |
0.1038 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.098 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205969.html