Information card for entry 2205989
| Common name |
4-TPST |
| Chemical name |
2,4,6-Tris(4-pyridylmethylsulfanyl)-1,3,5-triazine monohydrate |
| Formula |
C21 H20 N6 O S3 |
| Calculated formula |
C21 H20 N6 O S3 |
| SMILES |
S(c1nc(SCc2ccncc2)nc(SCc2ccncc2)n1)Cc1ccncc1.O |
| Title of publication |
2,4,6-Tris(4-pyridylmethylsulfanyl)-1,3,5-triazine monohydrate |
| Authors of publication |
Amoore, Jarrod J. M.; Kepert, Cameron J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1900 - o1901 |
| a |
8.436 ± 0.001 Å |
| b |
10.8759 ± 0.0012 Å |
| c |
12.1904 ± 0.0014 Å |
| α |
73.9052 ± 0.0018° |
| β |
85.9455 ± 0.0019° |
| γ |
81.3899 ± 0.0019° |
| Cell volume |
1062 ± 0.2 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.04 |
| Residual factor for significantly intense reflections |
0.0325 |
| Weighted residual factors for significantly intense reflections |
0.0783 |
| Weighted residual factors for all reflections included in the refinement |
0.0856 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205989.html