Information card for entry 2205999
| Chemical name |
10-Cyclopropyl-9-(4-methoxyphenyl)-1,2,3,4,5,6,7,8,9,10-decahydroacridine- 1,8-dione |
| Formula |
C23 H25 N O3 |
| Calculated formula |
C23 H25 N O3 |
| SMILES |
O=C1C2=C(N(C3=C(C2c2ccc(OC)cc2)C(=O)CCC3)C2CC2)CCC1 |
| Title of publication |
10-Cyclopropyl-9-(4-methoxyphenyl)-1,2,3,4,5,6,7,8,9,10-decahydroacridine-1,8-dione |
| Authors of publication |
Shu-Jiang Tu; Yan Zhang; Xiao-Jing Zhang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1885 - o1887 |
| a |
11.2668 ± 0.001 Å |
| b |
16.4542 ± 0.0012 Å |
| c |
10.8049 ± 0.0009 Å |
| α |
90° |
| β |
111.798 ± 0.002° |
| γ |
90° |
| Cell volume |
1859.9 ± 0.3 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0678 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for significantly intense reflections |
0.1341 |
| Weighted residual factors for all reflections included in the refinement |
0.1415 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.113 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2205999.html