Information card for entry 2206009
| Chemical name |
(1R,2R)-N,N'-bis(4-nitrophenylmethylene)cyclohexane-1,2-diamine |
| Formula |
C20 H20 N4 O4 |
| Calculated formula |
C20 H20 N4 O4 |
| SMILES |
[C@@H]1([C@@H](CCCC1)/N=C/c1ccc(cc1)N(=O)=O)/N=C/c1ccc(cc1)N(=O)=O |
| Title of publication |
(1<i>R</i>,2<i>R</i>)-<i>N,N</i>'-Bis(4-nitrophenylmethylene)cyclohexane-1,2-diamine |
| Authors of publication |
Glidewell, Christopher; Low, John N.; Skakle, Janet M. S.; Wardell, James L. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
6 |
| Pages of publication |
o1699 - o1701 |
| a |
52.275 ± 0.003 Å |
| b |
5.3605 ± 0.0002 Å |
| c |
14.0209 ± 0.0008 Å |
| α |
90° |
| β |
104.952 ± 0.002° |
| γ |
90° |
| Cell volume |
3795.9 ± 0.3 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.1205 |
| Residual factor for significantly intense reflections |
0.0602 |
| Weighted residual factors for significantly intense reflections |
0.1051 |
| Weighted residual factors for all reflections included in the refinement |
0.1243 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206009.html