Information card for entry 2206138
| Chemical name |
(E)-2,2,6,6-Tetramethyl-4-hepten-3-one |
| Formula |
C11 H20 O |
| Calculated formula |
C11 H20 O |
| SMILES |
O=C(C(C)(C)C)/C=C/C(C)(C)C |
| Title of publication |
(<i>E</i>)-2,2,6,6-Tetramethylhept-4-en-3-one |
| Authors of publication |
Jones, Peter G.; Bubenitschek, Peter; Hopf, Henning; Mlynek, Cornelia |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
7 |
| Pages of publication |
o2181 - o2182 |
| a |
5.8205 ± 0.0005 Å |
| b |
18.0795 ± 0.0015 Å |
| c |
10.6725 ± 0.001 Å |
| α |
90° |
| β |
94.324 ± 0.006° |
| γ |
90° |
| Cell volume |
1119.89 ± 0.17 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0714 |
| Residual factor for significantly intense reflections |
0.0401 |
| Weighted residual factors for significantly intense reflections |
0.0886 |
| Weighted residual factors for all reflections included in the refinement |
0.0981 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.928 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206138.html