Information card for entry 2206277
| Chemical name |
3-(2-Ethoxyphenyl)-6-phenyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazole |
| Formula |
C17 H14 N4 O S |
| Calculated formula |
C17 H14 N4 O S |
| SMILES |
s1c(nn2c1nnc2c1c(OCC)cccc1)c1ccccc1 |
| Title of publication |
3-(2-Ethoxyphenyl)-6-phenyl-1,2,4-triazolo[3,4-<i>b</i>][1,3,4]thiadiazole |
| Authors of publication |
Xiao-Bo Huang; Miao-Chang Liu; Li-Xue Zhang; An-Jiang Zhang; Ya-li Xu; Miao-lin Hu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
7 |
| Pages of publication |
o2233 - o2234 |
| a |
10.3988 ± 0.0009 Å |
| b |
8.7056 ± 0.0008 Å |
| c |
17.5354 ± 0.0016 Å |
| α |
90° |
| β |
102.184 ± 0.002° |
| γ |
90° |
| Cell volume |
1551.7 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.053 |
| Residual factor for significantly intense reflections |
0.0453 |
| Weighted residual factors for significantly intense reflections |
0.1113 |
| Weighted residual factors for all reflections included in the refinement |
0.1162 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206277.html