Information card for entry 2206330
| Chemical name |
2,6-Dibenzyl-8b,8c-diphenyl-2,3a,4a,6,7a,8a- hexaazaperhydrocyclopenta[def]fluorene-4,8-dione |
| Formula |
C34 H32 N6 O2 |
| Calculated formula |
C34 H32 N6 O2 |
| SMILES |
c1ccccc1CN1CN2C(=O)N3C4(C2(c2ccccc2)N(C1)C(=O)N4CN(C3)Cc1ccccc1)c1ccccc1 |
| Title of publication |
2,6-Dibenzyl-8b,8c-diphenyl-2,3a,4a,6,7a,8a-hexaazaperhydrocyclopenta[<i>def</i>]fluorene-4,8-dione |
| Authors of publication |
Li, Yi-Tao; Long, Tao; Wu, An-Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
8 |
| Pages of publication |
o2374 - o2375 |
| a |
11.7235 ± 0.0009 Å |
| b |
18.378 ± 0.0013 Å |
| c |
14.1604 ± 0.001 Å |
| α |
90° |
| β |
109.903 ± 0.001° |
| γ |
90° |
| Cell volume |
2868.7 ± 0.4 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1037 |
| Residual factor for significantly intense reflections |
0.0626 |
| Weighted residual factors for significantly intense reflections |
0.1321 |
| Weighted residual factors for all reflections included in the refinement |
0.1513 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206330.html