Information card for entry 2206360
| Chemical name |
10-Benzyl-3,3,6,6,9-pentamethyl-3,4,6,7,9,10-hexahydroacridine- 1,8(2H,5H)-dione |
| Formula |
C25 H31 N O2 |
| Calculated formula |
C25 H31 N O2 |
| SMILES |
O=C1CC(CC2=C1C(C1=C(CC(CC1=O)(C)C)N2Cc1ccccc1)C)(C)C |
| Title of publication |
10-Benzyl-3,3,6,6,9-pentamethyl-3,4,6,7,9,10-hexahydroacridine-1,8(2<i>H</i>,5<i>H</i>)-dione |
| Authors of publication |
M. Yogavel; D. Velmurugan; P. Murugan; S. Shanmuga Sundara Raj; H.-K. Fun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
8 |
| Pages of publication |
o2761 - o2763 |
| a |
10.3359 ± 0.0001 Å |
| b |
13.8339 ± 0.0003 Å |
| c |
16.2254 ± 0.0004 Å |
| α |
101.153 ± 0.001° |
| β |
90.934 ± 0.001° |
| γ |
108.687 ± 0.001° |
| Cell volume |
2148.53 ± 0.08 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1164 |
| Residual factor for significantly intense reflections |
0.065 |
| Weighted residual factors for significantly intense reflections |
0.1599 |
| Weighted residual factors for all reflections included in the refinement |
0.1968 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206360.html