Information card for entry 2206375
| Chemical name |
(meso-5,5,7,12,12,14-Hexamethyl-1,4,8,11-tetraazacyclotetradecane)zinc(II) diperchlorate |
| Formula |
C16 H32 Cl2 N4 O8 Zn |
| Calculated formula |
C16 H32 Cl2 N4 O8 Zn |
| SMILES |
C1(C)CC(C)(C)[NH]2[Zn]34[NH](CC[N]=13)C(CC(C)=[N]4CC2)(C)C.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O |
| Title of publication |
(<i>meso</i>-5,5,7,12,12,14-Hexamethyl-1,4,8,11-tetraazacyclotetradecane)zinc(II) diperchlorate |
| Authors of publication |
Yang, Yu-Min |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
8 |
| Pages of publication |
m1618 - m1619 |
| a |
10.323 ± 0.002 Å |
| b |
10.63 ± 0.002 Å |
| c |
11.018 ± 0.002 Å |
| α |
90° |
| β |
111.71 ± 0.03° |
| γ |
90° |
| Cell volume |
1123.3 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0478 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.1063 |
| Weighted residual factors for all reflections included in the refinement |
0.1086 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.144 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206375.html