Information card for entry 2206470
| Common name |
N,N'-Bis(N,N-dimethyl-p-toluidine)bis(ethoxycarbonyl)glycoluril |
| Chemical name |
Diethyl 4,8-dioxo-2,6-di-p-tolyl-1,3,5,7-tetrahydro-2,3a,4a,6,7a,8a- hexaazacyclopenta[def]fluorene-8b,8c-dicarboxylate |
| Formula |
C28 H32 N6 O6 |
| Calculated formula |
C28 H32 N6 O6 |
| SMILES |
Cc1ccc(cc1)N1CN2C(=O)N3C4(C2(C(=O)OCC)N(C1)C(=O)N4CN(C3)c1ccc(cc1)C)C(=O)OCC |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(<i>N</i>,<i>N</i>-dimethyl-<i>p</i>-toluidine)bis(ethoxycarbonyl)glycoluril |
| Authors of publication |
Yin, Guo-Dong; Zhou, Bao-Han; Chen, Yun-Feng; Wu, An-Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
8 |
| Pages of publication |
o2632 - o2634 |
| a |
9.7963 ± 0.0007 Å |
| b |
11.3007 ± 0.0008 Å |
| c |
24.0399 ± 0.0017 Å |
| α |
90° |
| β |
93.922 ± 0.001° |
| γ |
90° |
| Cell volume |
2655.1 ± 0.3 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.072 |
| Residual factor for significantly intense reflections |
0.0479 |
| Weighted residual factors for significantly intense reflections |
0.1194 |
| Weighted residual factors for all reflections included in the refinement |
0.1321 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.025 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206470.html