Information card for entry 2206587
| Chemical name |
2-(3-Bromo-4-butoxyphenyl)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)furan |
| Formula |
C25 H29 Br O5 |
| Calculated formula |
C25 H29 Br O5 |
| SMILES |
Brc1cc(c2oc(c(c2C)C)c2cc(OC)c(OC)c(OC)c2)ccc1OCCCC |
| Title of publication |
2-(3-Bromo-4-butoxyphenyl)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)furan |
| Authors of publication |
Wang, Run-Ling; Shi, Ji-Xian; Zheng, Xiu-Fang; Zhou, Ye |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
8 |
| Pages of publication |
o2619 - o2620 |
| a |
8.9854 ± 0.0017 Å |
| b |
11.955 ± 0.002 Å |
| c |
12.21 ± 0.002 Å |
| α |
71.179 ± 0.003° |
| β |
70.188 ± 0.003° |
| γ |
84.085 ± 0.003° |
| Cell volume |
1168 ± 0.4 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0881 |
| Residual factor for significantly intense reflections |
0.0421 |
| Weighted residual factors for significantly intense reflections |
0.0888 |
| Weighted residual factors for all reflections included in the refinement |
0.1097 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206587.html