Information card for entry 2206595
| Chemical name |
Diethyl 4,8-dioxo-2,6-diphenyl-1,3,5,7-tetrahydro-2,3a,4a,6,7a,8a- hexaazacyclopenta[def]fluorene-8b,8c-dicarboxylate |
| Formula |
C26 H28 N6 O6 |
| Calculated formula |
C26 H28 N6 O6 |
| SMILES |
CCOC(=O)[C@]12N3CN(CN1C(=O)N1[C@@]2(C(=O)OCC)N(C3=O)CN(C1)c1ccccc1)c1ccccc1 |
| Title of publication |
Diethyl 4,8-dioxo-2,6-diphenyl-1,3,5,7-tetrahydro-2,3a,4a,6,7a,8a-hexaazacyclopenta[<i>def</i>]fluorene-8b,8c-dicarboxylate |
| Authors of publication |
Yin, Guo-Dong; Chen, Yun-Feng; Zhou, Bao-Han; Wu, An-Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
8 |
| Pages of publication |
o2467 - o2469 |
| a |
18.0634 ± 0.0016 Å |
| b |
15.1108 ± 0.0013 Å |
| c |
18.8377 ± 0.0017 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5141.8 ± 0.8 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.079 |
| Residual factor for significantly intense reflections |
0.0574 |
| Weighted residual factors for significantly intense reflections |
0.1528 |
| Weighted residual factors for all reflections included in the refinement |
0.1805 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.178 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206595.html