Information card for entry 2206619
| Common name |
3,3',5,5'-Tetrabromo-4,4'-dihydroxybiphenyl |
| Chemical name |
3,3',5,5'-Tetrabromo-4,4'-dihydroxybiphenyl |
| Formula |
C12 H6 Br4 O2 |
| Calculated formula |
C12 H6 Br4 O2 |
| SMILES |
Brc1cc(cc(c1O)Br)c1cc(Br)c(c(c1)Br)O |
| Title of publication |
3,3',5,5'-Tetrabromo-4,4'-dihydroxybiphenyl |
| Authors of publication |
Lehmler, H.-J.; Parkin, S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
9 |
| Pages of publication |
o2828 - o2830 |
| a |
23.4583 ± 0.0009 Å |
| b |
3.8928 ± 0.0002 Å |
| c |
7.5495 ± 0.0003 Å |
| α |
90° |
| β |
108.376 ± 0.002° |
| γ |
90° |
| Cell volume |
654.25 ± 0.05 Å3 |
| Cell temperature |
90 ± 0.2 K |
| Ambient diffraction temperature |
90 ± 0.2 K |
| Number of distinct elements |
4 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.024 |
| Residual factor for significantly intense reflections |
0.022 |
| Weighted residual factors for significantly intense reflections |
0.047 |
| Weighted residual factors for all reflections included in the refinement |
0.048 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206619.html