Information card for entry 2206785
| Chemical name |
1-[(4-Nitrophenoxy)acetyl]-3-(5-thioxo-4,5-dihydro-1,3,4-thiadiazolin-2-yl)urea dimethylformamide solvate |
| Formula |
C14 H16 N6 O6 S2 |
| Calculated formula |
C14 H16 N6 O6 S2 |
| SMILES |
c1(ccc(cc1)OCC(=O)NC(=O)NC1=NNC(=S)S1)N(=O)=O.CN(C)C=O |
| Title of publication |
1-[(4-Nitrophenoxy)acetyl]-3-(5-thioxo-4,5-dihydro-1,3,4-thiadiazolin-2-yl)urea dimethylformamide solvate |
| Authors of publication |
Song, Xin-Jian; Tan, Xiao-Hong; Li, Yao-Hua; Zhang, Zheng-Wen; Wang, Yan-Gang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
9 |
| Pages of publication |
o3066 - o3068 |
| a |
7.9981 ± 0.0012 Å |
| b |
11.3139 ± 0.0016 Å |
| c |
12.0232 ± 0.0017 Å |
| α |
68.893 ± 0.002° |
| β |
70.744 ± 0.002° |
| γ |
70.897 ± 0.002° |
| Cell volume |
931 ± 0.2 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0671 |
| Residual factor for significantly intense reflections |
0.0469 |
| Weighted residual factors for significantly intense reflections |
0.1096 |
| Weighted residual factors for all reflections included in the refinement |
0.1306 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.017 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206785.html