Information card for entry 2206980
| Chemical name |
5-((1H-1,2,4-triazol-1-yl)methyl)-4-(4-fluorobenzylideneamino)-2H- 1,2,4-triazole-3(4H)-thione |
| Formula |
C12 H10 F N7 S |
| Calculated formula |
C12 H10 F N7 S |
| SMILES |
S=C1NN=C(N1/N=C/c1ccc(F)cc1)Cn1ncnc1 |
| Title of publication |
5-[(1<i>H</i>-1,2,4-Yriazol-1-yl)methyl]-4-(4-fluorobenzylideneamino)-2<i>H</i>-1,2,4-triazole-3(4<i>H</i>)-thione |
| Authors of publication |
Yang, Xiu-Ying; Shang, Yu-Qing; Yu, Guan-Ping; Zhang, Pu-Yong; Li, Wei-Hua; Hou, Bao-Rong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
10 |
| Pages of publication |
o3371 - o3372 |
| a |
7.146 ± 0.004 Å |
| b |
17.906 ± 0.009 Å |
| c |
21.697 ± 0.011 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2776 ± 3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0978 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.0909 |
| Weighted residual factors for all reflections included in the refinement |
0.1108 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2206980.html