Information card for entry 2207108
| Chemical name |
Diethyl 2,6-bis(2-hydroxyethyl)-4,8-dioxo-1,2,5,6-tetrahydrohydro-2,3a,4a,6,7a,8a- hexaazacyclopenta[def]fluorene-8b,8c-dicarboxylate |
| Formula |
C18 H28 N6 O8 |
| Calculated formula |
C18 H28 N6 O8 |
| SMILES |
C(CN1CN2C(=O)N3C4(C2(C(=O)OCC)N(C1)C(=O)N4CN(C3)CCO)C(=O)OCC)O |
| Title of publication |
Diethyl 2,6-bis(2-hydroxyethyl)-4,8-dioxo-1,2,5,6-tetrahydrohydro-2,3a,4a,6,7a,8a-hexaazacyclopenta[<i>def</i>]fluorene-8b,8c-dicarboxylate |
| Authors of publication |
Li, Yi-Tao; Chen, Yun-Feng; She, Neng-Fang; Wu, An-Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
10 |
| Pages of publication |
o3364 - o3365 |
| a |
10.116 ± 0.002 Å |
| b |
8.7131 ± 0.0018 Å |
| c |
24.608 ± 0.005 Å |
| α |
90° |
| β |
96.763 ± 0.004° |
| γ |
90° |
| Cell volume |
2153.9 ± 0.8 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.069 |
| Residual factor for significantly intense reflections |
0.054 |
| Weighted residual factors for significantly intense reflections |
0.14 |
| Weighted residual factors for all reflections included in the refinement |
0.155 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207108.html