Information card for entry 2207223
| Chemical name |
Ethene-1,1,2,2-tetrayltetramethylene tetrathiocyanate |
| Formula |
C10 H8 N4 S4 |
| Calculated formula |
C10 H8 N4 S4 |
| SMILES |
S(CC(=C(CSC#N)CSC#N)CSC#N)C#N |
| Title of publication |
Ethene-1,1,2,2-tetrayltetramethylene tetrathiocyanate |
| Authors of publication |
Ustabaş, Reşat; Sancak, Kemal; Er, Mustafa; Ünver, Yasemin; Çoruh, Ufuk; Vázquez-López, Ezequiel M.; Yavuz, Metin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
11 |
| Pages of publication |
o3529 - o3531 |
| a |
11.5149 ± 0.0014 Å |
| b |
8.6821 ± 0.001 Å |
| c |
14.1549 ± 0.0017 Å |
| α |
90° |
| β |
108.2 ± 0.002° |
| γ |
90° |
| Cell volume |
1344.3 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0549 |
| Residual factor for significantly intense reflections |
0.0418 |
| Weighted residual factors for significantly intense reflections |
0.1122 |
| Weighted residual factors for all reflections included in the refinement |
0.1174 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.081 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207223.html