Information card for entry 2207304
| Chemical name |
Triaqua(pyridine-2,5-dicarboxylato-κ^2^N,O^2^)[4,4,5,5-tetramethyl- 2-(4-pyridyl)imidazoline-1-oxyl-κN^2^]zinc(II) |
| Formula |
C19 H25 N4 O8 Zn |
| Calculated formula |
C19 H25 N4 O8 Zn |
| SMILES |
[Zn]1(OC(=O)c2[n]1cc(cc2)C(=O)[O-])([OH2])([OH2])([OH2])[n]1ccc(cc1)C1=NC(C([N]1=O)(C)C)(C)C |
| Title of publication |
Triaqua(pyridine-2,5-dicarboxylato-κ^2^<i>N</i>,<i>O</i>^2^)[4,4,5,5-tetramethyl-2-(4-pyridyl)imidazoline-1-oxyl-κ<i>N</i>^2^]zinc(II) |
| Authors of publication |
Dong-Zhao Gao; Zong-Hui Jiang; Dai-Zheng Liao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
11 |
| Pages of publication |
m2446 - m2448 |
| a |
16.978 ± 0.006 Å |
| b |
7.355 ± 0.003 Å |
| c |
18.812 ± 0.007 Å |
| α |
90° |
| β |
108.867 ± 0.005° |
| γ |
90° |
| Cell volume |
2222.9 ± 1.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0376 |
| Residual factor for significantly intense reflections |
0.0283 |
| Weighted residual factors for significantly intense reflections |
0.0735 |
| Weighted residual factors for all reflections included in the refinement |
0.0771 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207304.html