Information card for entry 2207338
| Common name |
tanshinone I |
| Chemical name |
1,6-Dimethylphenanthro[1,2-b]furan-10,11-dione |
| Formula |
C18 H12 O3 |
| Calculated formula |
C18 H12 O3 |
| SMILES |
Cc1cccc2c1ccc1c2C(=O)C(=O)c2c1occ2C |
| Title of publication |
1,6-Dimethylphenanthro[1,2-<i>b</i>]furan-10,11-dione |
| Authors of publication |
Zhang, Lei; Wang, Jing-Kang; Qu, Yi; Nie, Qiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
11 |
| Pages of publication |
o3582 - o3583 |
| a |
7.0989 ± 0.0014 Å |
| b |
7.9539 ± 0.0016 Å |
| c |
12.162 ± 0.002 Å |
| α |
90.79 ± 0.03° |
| β |
105.76 ± 0.03° |
| γ |
99.65 ± 0.03° |
| Cell volume |
650.3 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0612 |
| Residual factor for significantly intense reflections |
0.0455 |
| Weighted residual factors for significantly intense reflections |
0.1394 |
| Weighted residual factors for all reflections included in the refinement |
0.1568 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.005 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207338.html