Information card for entry 2207425
| Chemical name |
N,N-Dibenzyl-4-(4,4-diphenylbuta-1,3-dienyl)-3-methylaniline |
| Formula |
C37 H33 N |
| Calculated formula |
C37 H33 N |
| SMILES |
N(c1ccc(/C=C\C=C(c2ccccc2)/c2ccccc2)c(c1)C)(Cc1ccccc1)Cc1ccccc1 |
| Title of publication |
<i>N</i>,<i>N</i>-Dibenzyl-4-(4,4-diphenylbuta-1,3-dienyl)-3-methylaniline |
| Authors of publication |
Wu, An-Shu; Li, Xiang-Gao; Xu, De-Shun; Wang, Shi-Rong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
12 |
| Pages of publication |
o4167 - o4168 |
| a |
6.1629 ± 0.0016 Å |
| b |
15.935 ± 0.004 Å |
| c |
16.323 ± 0.004 Å |
| α |
117.824 ± 0.004° |
| β |
90.749 ± 0.005° |
| γ |
99.054 ± 0.005° |
| Cell volume |
1393.1 ± 0.6 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.118 |
| Residual factor for significantly intense reflections |
0.054 |
| Weighted residual factors for all reflections included in the refinement |
0.131 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207425.html