Information card for entry 2207453
| Chemical name |
5-[(2-Bromophenylamino)methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Formula |
C13 H12 Br N O4 |
| Calculated formula |
C13 H12 Br N O4 |
| SMILES |
Brc1ccccc1NC=C1C(=O)OC(OC1=O)(C)C |
| Title of publication |
5-[(2-Bromophenylamino)methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Authors of publication |
Silva, Luiz Everson da; Joussef, Antonio Carlos; Nunes, Ricardo José; Andrighetti-Fröhner, Carla Regina; Bortoluzzi, Adailton José |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
12 |
| Pages of publication |
o4252 - o4253 |
| a |
6.96 ± 0.005 Å |
| b |
9.298 ± 0.005 Å |
| c |
10.424 ± 0.005 Å |
| α |
95.57 ± 0.005° |
| β |
101.043 ± 0.005° |
| γ |
99.508 ± 0.005° |
| Cell volume |
647.2 ± 0.7 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0651 |
| Residual factor for significantly intense reflections |
0.0302 |
| Weighted residual factors for significantly intense reflections |
0.0657 |
| Weighted residual factors for all reflections included in the refinement |
0.0733 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.064 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207453.html