Information card for entry 2207457
| Chemical name |
N-[4-(2,4-Difluorophenyl]-5-(1H-1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]-2- fluorobenzamide |
| Formula |
C18 H10 F3 N5 O S |
| Calculated formula |
C18 H10 F3 N5 O S |
| SMILES |
Fc1ccc(c(c1)F)c1nc(sc1n1cncn1)NC(=O)c1ccccc1F |
| Title of publication |
<i>N</i>-[4-(2,4-Difluorophenyl)-5-(1<i>H</i>-1,2,4-triazol-1-yl)-1,3-thiazol-2-yl]-2-fluorobenzamide |
| Authors of publication |
Du, Ding; Lu, Yan-Chang; Dai, Hong; Liu, Jian-Bing; Fang, Jian-Xin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
12 |
| Pages of publication |
o4241 - o4242 |
| a |
6.986 ± 0.002 Å |
| b |
24.629 ± 0.007 Å |
| c |
10.333 ± 0.003 Å |
| α |
90° |
| β |
92.399 ± 0.005° |
| γ |
90° |
| Cell volume |
1776.3 ± 0.9 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0597 |
| Residual factor for significantly intense reflections |
0.0333 |
| Weighted residual factors for significantly intense reflections |
0.0672 |
| Weighted residual factors for all reflections included in the refinement |
0.0771 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207457.html