Information card for entry 2207814
| Chemical name |
4-(3,4-Dimethoxyphenyl)-2-oxo-N,3-bis(3,4,5-trimethoxyphenyl)- 2,3-dihydro-1H-imidazoline-1-carboxamide |
| Formula |
C30 H33 N3 O10 |
| Calculated formula |
C30 H33 N3 O10 |
| SMILES |
O=C(Nc1cc(OC)c(OC)c(OC)c1)n1cc(n(c1=O)c1cc(OC)c(OC)c(OC)c1)c1ccc(OC)c(OC)c1 |
| Title of publication |
4-(3,4-Dimethoxyphenyl)-2-oxo-<i>N</i>,3-bis(3,4,5-trimethoxyphenyl)-2,3-dihydro-1<i>H</i>-imidazoline-1-carboxamide |
| Authors of publication |
Na Xue; Yong-Zhou Hu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
1 |
| Pages of publication |
o327 - o328 |
| a |
9.429 ± 0.004 Å |
| b |
11.209 ± 0.004 Å |
| c |
15.89 ± 0.007 Å |
| α |
93.802 ± 0.015° |
| β |
104.333 ± 0.016° |
| γ |
112.476 ± 0.014° |
| Cell volume |
1479 ± 1.1 Å3 |
| Cell temperature |
296 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.0571 |
| Weighted residual factors for all reflections included in the refinement |
0.1305 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.013 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207814.html
