Information card for entry 2208378
| Chemical name |
1,2-Bis(2-ethyl-5-hydroxymethyl-3-thienyl)-3,3,4,4,5,5- hexafluorocyclopent-1-ene |
| Formula |
C19 H18 F6 O2 S2 |
| Calculated formula |
C19 H18 F6 O2 S2 |
| SMILES |
OCc1cc(c(s1)CC)C1=C(c2cc(sc2CC)CO)C(C(C1(F)F)(F)F)(F)F |
| Title of publication |
1,2-Bis(2-ethyl-5-hydroxymethyl-3-thienyl)-3,3,4,4,5,5-hexafluorocyclopent-1-ene, a new photochromic diarylethene compound |
| Authors of publication |
Yang, Tian-She; Pu, Shou-Zhi; Luo, Fu-Sheng; Xu, Jing-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
3 |
| Pages of publication |
o1136 - o1138 |
| a |
12.902 ± 0.002 Å |
| b |
8.6229 ± 0.0014 Å |
| c |
18.972 ± 0.003 Å |
| α |
90° |
| β |
101.588 ± 0.003° |
| γ |
90° |
| Cell volume |
2067.7 ± 0.6 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0921 |
| Residual factor for significantly intense reflections |
0.0506 |
| Weighted residual factors for significantly intense reflections |
0.1315 |
| Weighted residual factors for all reflections included in the refinement |
0.1574 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2208378.html