Information card for entry 2208382
| Chemical name |
Aqua(dipicolinato-κ^3^O,N,O')(1,10-phenanthroline-κ^2^N,N)zinc(II) monohydrate |
| Formula |
C19 H15 N3 O6 Zn |
| Calculated formula |
C19 H15 N3 O6 Zn |
| SMILES |
[Zn]123([n]4cccc5ccc6ccc[n]1c6c45)([n]1c(C(=O)O2)cccc1C(=O)O3)[OH2].O |
| Title of publication |
Aqua(dipicolinato-κ^3^<i>O</i>,<i>N</i>,<i>O</i>')(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')zinc(II) monohydrate |
| Authors of publication |
Harrison, William T. A.; Ramadevi, Palani; Kumaresan, Sudalaiandi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
3 |
| Pages of publication |
m513 - m515 |
| a |
7.5199 ± 0.0003 Å |
| b |
20.9079 ± 0.0008 Å |
| c |
11.5755 ± 0.0004 Å |
| α |
90° |
| β |
100.135 ± 0.001° |
| γ |
90° |
| Cell volume |
1791.56 ± 0.12 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0518 |
| Residual factor for significantly intense reflections |
0.031 |
| Weighted residual factors for significantly intense reflections |
0.0744 |
| Weighted residual factors for all reflections included in the refinement |
0.0804 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.967 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2208382.html