Information card for entry 2208670
| Chemical name |
1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one |
| Formula |
C19 H18 O3 |
| Calculated formula |
C19 H18 O3 |
| SMILES |
COc1ccc(cc1)/C=C/C(=O)/C=C/c1ccc(cc1)OC |
| Title of publication |
A redetermination of 1,5-bis(4-methoxyphenyl)penta-1,4-dien-3-one at 120(2)K |
| Authors of publication |
Harrison, William T. A.; Sarojini, B. K.; Vijaya Raj, K. K.; Yathirajan, H. S.; Narayana, B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
4 |
| Pages of publication |
o1522 - o1523 |
| a |
7.2756 ± 0.0009 Å |
| b |
33.583 ± 0.0006 Å |
| c |
6.132 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1498.3 ± 1.2 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
41 |
| Hermann-Mauguin space group symbol |
A b a 2 |
| Hall space group symbol |
A 2 -2ab |
| Residual factor for all reflections |
0.104 |
| Residual factor for significantly intense reflections |
0.0519 |
| Weighted residual factors for significantly intense reflections |
0.1059 |
| Weighted residual factors for all reflections included in the refinement |
0.1267 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.102 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2208670.html