Information card for entry 2209024
| Chemical name |
2,6-Diisopropyl-2,3,6,7-tetrahydro-2,3a,4a,6,7a,8a-hexaaza-1H,5H- cyclopenta[def]fluorene-4,8-dione |
| Formula |
C14 H24 N6 O2 |
| Calculated formula |
C14 H24 N6 O2 |
| SMILES |
CC(C)N1CN2C(=O)N3C4C2N(C1)C(=O)N4CN(C3)C(C)C |
| Title of publication |
2,6-Diisopropyl-2,3,6,7-tetrahydro-2,3a,4a,6,7a,8a-hexaaza-1<i>H</i>,5<i>H</i>-cyclopenta[<i>def</i>]fluorene-4,8-dione |
| Authors of publication |
Qin, Shu-Qi; Li, Yi-Tao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
5 |
| Pages of publication |
o1812 - o1813 |
| a |
13.1492 ± 0.0017 Å |
| b |
7.7672 ± 0.001 Å |
| c |
14.9337 ± 0.0019 Å |
| α |
90° |
| β |
94.934 ± 0.002° |
| γ |
90° |
| Cell volume |
1519.6 ± 0.3 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0713 |
| Residual factor for significantly intense reflections |
0.0517 |
| Weighted residual factors for significantly intense reflections |
0.128 |
| Weighted residual factors for all reflections included in the refinement |
0.1358 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.992 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209024.html