Information card for entry 2209360
| Chemical name |
Cyclooctane-1,2,5,6-tetrayl tetraacetate |
| Formula |
C16 H24 O8 |
| Calculated formula |
C16 H24 O8 |
| SMILES |
O([C@H]1[C@@H](OC(=O)C)CC[C@@H](OC(=O)C)[C@@H](OC(=O)C)CC1)C(=O)C |
| Title of publication |
Cyclooctane-1,2,5,6-tetrayl tetraacetate |
| Authors of publication |
Salamci, Emine; Ustabaş, Reşat; Çoruh, Ufuk; Yavuz, Metin; Vázquez-López, Ezequiel M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
6 |
| Pages of publication |
o2401 - o2402 |
| a |
11.8989 ± 0.0012 Å |
| b |
7.7568 ± 0.0008 Å |
| c |
20.08 ± 0.002 Å |
| α |
90° |
| β |
93.567 ± 0.002° |
| γ |
90° |
| Cell volume |
1849.7 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.168 |
| Residual factor for significantly intense reflections |
0.055 |
| Weighted residual factors for significantly intense reflections |
0.121 |
| Weighted residual factors for all reflections included in the refinement |
0.148 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.841 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209360.html