Information card for entry 2210106
| Chemical name |
Dimethyl 2,6-dimethyl-4-[4-(benzoyloxy)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| Formula |
C24 H23 N O6 |
| Calculated formula |
C24 H23 N O6 |
| SMILES |
C1(=C(C(C(=C(C)N1)C(=O)OC)c1ccc(cc1)OC(=O)c1ccccc1)C(=O)OC)C |
| Title of publication |
Dimethyl 4-[4-(benzoyloxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Authors of publication |
Sundar, T. V.; Parthasarathi, V.; Bansal, Ranju; Sridhar, B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
o3701 - o3703 |
| a |
7.8943 ± 0.0006 Å |
| b |
10.6426 ± 0.0008 Å |
| c |
25.7386 ± 0.0018 Å |
| α |
90° |
| β |
94.642 ± 0.001° |
| γ |
90° |
| Cell volume |
2155.4 ± 0.3 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0721 |
| Residual factor for significantly intense reflections |
0.0496 |
| Weighted residual factors for significantly intense reflections |
0.1236 |
| Weighted residual factors for all reflections included in the refinement |
0.134 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210106.html